C14H21FIN3 — CID 111285056
3-ethyl-1-[(3-fluorophenyl)methyl]-1-methyl-2-prop-2-enylguanidine;hydroiodide (PubChem CID 111285056) has the molecular formula C14H21FIN3 and a molecular weight of 377.25 g/mol. Its IUPAC name is 3-ethyl-1-[(3-fluorophenyl)methyl]-1-methyl-2-prop-2-enylguanidine;hydroiodide.
| Compound Name | 3-ethyl-1-[(3-fluorophenyl)methyl]-1-methyl-2-prop-2-enylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111285056 |
| Molecular Formula | C14H21FIN3 |
| Molecular Weight | 377.25 g/mol |
| Exact Mass | 377.08 |
| IUPAC Name | 3-ethyl-1-[(3-fluorophenyl)methyl]-1-methyl-2-prop-2-enylguanidine;hydroiodide |
| SMILES | C=CC/N=C(\NCC)N(C)Cc1cccc(F)c1.I |
| InChI | InChI=1S/C14H20FN3.HI/c1-4-9-17-14(16-5-2)18(3)11-12-7-6-8-13(15)10-12;/h4,6-8,10H,1,5,9,11H2,2-3H3,(H,16,17);1H |
| InChIKey | AHVYSYPPRKPTNT-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.25 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|