C20H27FIN3O3 — CID 111285874
3-ethyl-1-[(3-fluorophenyl)methyl]-2-[(4-hydroxy-3,5-dimethoxyphenyl)methyl]-1-methylguanidine;hydroiodide (PubChem CID 111285874) has the molecular formula C20H27FIN3O3 and a molecular weight of 503.36 g/mol. Its IUPAC name is 3-ethyl-1-[(3-fluorophenyl)methyl]-2-[(4-hydroxy-3,5-dimethoxyphenyl)methyl]-1-methylguanidine;hydroiodide.
| Compound Name | 3-ethyl-1-[(3-fluorophenyl)methyl]-2-[(4-hydroxy-3,5-dimethoxyphenyl)methyl]-1-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111285874 |
| Molecular Formula | C20H27FIN3O3 |
| Molecular Weight | 503.36 g/mol |
| Exact Mass | 503.11 |
| IUPAC Name | 3-ethyl-1-[(3-fluorophenyl)methyl]-2-[(4-hydroxy-3,5-dimethoxyphenyl)methyl]-1-methylguanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1cc(OC)c(O)c(OC)c1)N(C)Cc1cccc(F)c1.I |
| InChI | InChI=1S/C20H26FN3O3.HI/c1-5-22-20(24(2)13-14-7-6-8-16(21)9-14)23-12-15-10-17(26-3)19(25)18(11-15)27-4;/h6-11,25H,5,12-13H2,1-4H3,(H,22,23);1H |
| InChIKey | OPPWASREWFFRLW-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 66.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.36 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|