C16H21ClF2IN5 — CID 111305460
1-[(3-chlorophenyl)methyl]-2-[[1-(difluoromethyl)imidazol-2-yl]methyl]-3-ethyl-1-methylguanidine;hydroiodide (PubChem CID 111305460) has the molecular formula C16H21ClF2IN5 and a molecular weight of 483.73 g/mol. Its IUPAC name is 1-[(3-chlorophenyl)methyl]-2-[[1-(difluoromethyl)imidazol-2-yl]methyl]-3-ethyl-1-methylguanidine;hydroiodide.
| Compound Name | 1-[(3-chlorophenyl)methyl]-2-[[1-(difluoromethyl)imidazol-2-yl]methyl]-3-ethyl-1-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111305460 |
| Molecular Formula | C16H21ClF2IN5 |
| Molecular Weight | 483.73 g/mol |
| Exact Mass | 483.05 |
| IUPAC Name | 1-[(3-chlorophenyl)methyl]-2-[[1-(difluoromethyl)imidazol-2-yl]methyl]-3-ethyl-1-methylguanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1nccn1C(F)F)N(C)Cc1cccc(Cl)c1.I |
| InChI | InChI=1S/C16H20ClF2N5.HI/c1-3-20-16(22-10-14-21-7-8-24(14)15(18)19)23(2)11-12-5-4-6-13(17)9-12;/h4-9,15H,3,10-11H2,1-2H3,(H,20,22);1H |
| InChIKey | DQCUPCGHIFYNLP-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 45.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.73 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|