C20H24ClIN6 — CID 111305690
1-[(3-chlorophenyl)methyl]-3-ethyl-1-methyl-2-[(4-phenyl-1,2,4-triazol-3-yl)methyl]guanidine;hydroiodide (PubChem CID 111305690) has the molecular formula C20H24ClIN6 and a molecular weight of 510.81 g/mol. Its IUPAC name is 1-[(3-chlorophenyl)methyl]-3-ethyl-1-methyl-2-[(4-phenyl-1,2,4-triazol-3-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[(3-chlorophenyl)methyl]-3-ethyl-1-methyl-2-[(4-phenyl-1,2,4-triazol-3-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111305690 |
| Molecular Formula | C20H24ClIN6 |
| Molecular Weight | 510.81 g/mol |
| Exact Mass | 510.08 |
| IUPAC Name | 1-[(3-chlorophenyl)methyl]-3-ethyl-1-methyl-2-[(4-phenyl-1,2,4-triazol-3-yl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1nncn1-c1ccccc1)N(C)Cc1cccc(Cl)c1.I |
| InChI | InChI=1S/C20H23ClN6.HI/c1-3-22-20(26(2)14-16-8-7-9-17(21)12-16)23-13-19-25-24-15-27(19)18-10-5-4-6-11-18;/h4-12,15H,3,13-14H2,1-2H3,(H,22,23);1H |
| InChIKey | MZSKKPKYVLJTGB-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 58.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.81 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|