C20H31IN6 — CID 109483220
3-ethyl-1-hept-6-enyl-1-methyl-2-[(4-phenyl-1,2,4-triazol-3-yl)methyl]guanidine;hydroiodide (PubChem CID 109483220) has the molecular formula C20H31IN6 and a molecular weight of 482.41 g/mol. Its IUPAC name is 3-ethyl-1-hept-6-enyl-1-methyl-2-[(4-phenyl-1,2,4-triazol-3-yl)methyl]guanidine;hydroiodide.
| Compound Name | 3-ethyl-1-hept-6-enyl-1-methyl-2-[(4-phenyl-1,2,4-triazol-3-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 109483220 |
| Molecular Formula | C20H31IN6 |
| Molecular Weight | 482.41 g/mol |
| Exact Mass | 482.17 |
| IUPAC Name | 3-ethyl-1-hept-6-enyl-1-methyl-2-[(4-phenyl-1,2,4-triazol-3-yl)methyl]guanidine;hydroiodide |
| SMILES | C=CCCCCCN(C)/C(=N/Cc1nncn1-c1ccccc1)NCC.I |
| InChI | InChI=1S/C20H30N6.HI/c1-4-6-7-8-12-15-25(3)20(21-5-2)22-16-19-24-23-17-26(19)18-13-10-9-11-14-18;/h4,9-11,13-14,17H,1,5-8,12,15-16H2,2-3H3,(H,21,22);1H |
| InChIKey | GWUJBTUYUNVXEY-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 58.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.41 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|