C20H30IN5 — CID 109497849
2-[(1-benzylimidazol-2-yl)methyl]-3-ethyl-1-methyl-1-pent-4-enylguanidine;hydroiodide (PubChem CID 109497849) has the molecular formula C20H30IN5 and a molecular weight of 467.40 g/mol. Its IUPAC name is 2-[(1-benzylimidazol-2-yl)methyl]-3-ethyl-1-methyl-1-pent-4-enylguanidine;hydroiodide.
| Compound Name | 2-[(1-benzylimidazol-2-yl)methyl]-3-ethyl-1-methyl-1-pent-4-enylguanidine;hydroiodide |
|---|---|
| PubChem CID | 109497849 |
| Molecular Formula | C20H30IN5 |
| Molecular Weight | 467.40 g/mol |
| Exact Mass | 467.15 |
| IUPAC Name | 2-[(1-benzylimidazol-2-yl)methyl]-3-ethyl-1-methyl-1-pent-4-enylguanidine;hydroiodide |
| SMILES | C=CCCCN(C)/C(=N/Cc1nccn1Cc1ccccc1)NCC.I |
| InChI | InChI=1S/C20H29N5.HI/c1-4-6-10-14-24(3)20(21-5-2)23-16-19-22-13-15-25(19)17-18-11-8-7-9-12-18;/h4,7-9,11-13,15H,1,5-6,10,14,16-17H2,2-3H3,(H,21,23);1H |
| InChIKey | XICQIXMDCOBYLB-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 45.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.40 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|