C19H28IN5 — CID 109498647
3-ethyl-1-methyl-1-pent-4-enyl-2-[(5-phenyl-1H-imidazol-2-yl)methyl]guanidine;hydroiodide (PubChem CID 109498647) has the molecular formula C19H28IN5 and a molecular weight of 453.37 g/mol. Its IUPAC name is 3-ethyl-1-methyl-1-pent-4-enyl-2-[(5-phenyl-1H-imidazol-2-yl)methyl]guanidine;hydroiodide.
| Compound Name | 3-ethyl-1-methyl-1-pent-4-enyl-2-[(5-phenyl-1H-imidazol-2-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 109498647 |
| Molecular Formula | C19H28IN5 |
| Molecular Weight | 453.37 g/mol |
| Exact Mass | 453.14 |
| IUPAC Name | 3-ethyl-1-methyl-1-pent-4-enyl-2-[(5-phenyl-1H-imidazol-2-yl)methyl]guanidine;hydroiodide |
| SMILES | C=CCCCN(C)/C(=N/Cc1ncc(-c2ccccc2)[nH]1)NCC.I |
| InChI | InChI=1S/C19H27N5.HI/c1-4-6-10-13-24(3)19(20-5-2)22-15-18-21-14-17(23-18)16-11-8-7-9-12-16;/h4,7-9,11-12,14H,1,5-6,10,13,15H2,2-3H3,(H,20,22)(H,21,23);1H |
| InChIKey | VNZSCLDICALBDG-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 56.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.37 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|