C16H29IN4S — CID 109483402
3-ethyl-1-hept-6-enyl-1-methyl-2-[(2-methyl-1,3-thiazol-5-yl)methyl]guanidine;hydroiodide (PubChem CID 109483402) has the molecular formula C16H29IN4S and a molecular weight of 436.41 g/mol. Its IUPAC name is 3-ethyl-1-hept-6-enyl-1-methyl-2-[(2-methyl-1,3-thiazol-5-yl)methyl]guanidine;hydroiodide.
| Compound Name | 3-ethyl-1-hept-6-enyl-1-methyl-2-[(2-methyl-1,3-thiazol-5-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 109483402 |
| Molecular Formula | C16H29IN4S |
| Molecular Weight | 436.41 g/mol |
| Exact Mass | 436.12 |
| IUPAC Name | 3-ethyl-1-hept-6-enyl-1-methyl-2-[(2-methyl-1,3-thiazol-5-yl)methyl]guanidine;hydroiodide |
| SMILES | C=CCCCCCN(C)/C(=N/Cc1cnc(C)s1)NCC.I |
| InChI | InChI=1S/C16H28N4S.HI/c1-5-7-8-9-10-11-20(4)16(17-6-2)19-13-15-12-18-14(3)21-15;/h5,12H,1,6-11,13H2,2-4H3,(H,17,19);1H |
| InChIKey | OWGCTYQMXZELLX-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 40.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.41 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|