C17H31IN6 — CID 109483266
2-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-ylmethyl)-3-ethyl-1-hept-6-enyl-1-methylguanidine;hydroiodide (PubChem CID 109483266) has the molecular formula C17H31IN6 and a molecular weight of 446.38 g/mol. Its IUPAC name is 2-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-ylmethyl)-3-ethyl-1-hept-6-enyl-1-methylguanidine;hydroiodide.
| Compound Name | 2-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-ylmethyl)-3-ethyl-1-hept-6-enyl-1-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 109483266 |
| Molecular Formula | C17H31IN6 |
| Molecular Weight | 446.38 g/mol |
| Exact Mass | 446.17 |
| IUPAC Name | 2-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-ylmethyl)-3-ethyl-1-hept-6-enyl-1-methylguanidine;hydroiodide |
| SMILES | C=CCCCCCN(C)/C(=N/Cc1nnc2n1CCC2)NCC.I |
| InChI | InChI=1S/C17H30N6.HI/c1-4-6-7-8-9-12-22(3)17(18-5-2)19-14-16-21-20-15-11-10-13-23(15)16;/h4H,1,5-14H2,2-3H3,(H,18,19);1H |
| InChIKey | FSMMUDVBMMUHBG-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 58.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.38 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|