C18H25Cl2IN6 — CID 111306240
1-[(3,4-dichlorophenyl)methyl]-3-ethyl-1-methyl-2-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide (PubChem CID 111306240) has the molecular formula C18H25Cl2IN6 and a molecular weight of 523.25 g/mol. Its IUPAC name is 1-[(3,4-dichlorophenyl)methyl]-3-ethyl-1-methyl-2-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide.
| Compound Name | 1-[(3,4-dichlorophenyl)methyl]-3-ethyl-1-methyl-2-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111306240 |
| Molecular Formula | C18H25Cl2IN6 |
| Molecular Weight | 523.25 g/mol |
| Exact Mass | 522.06 |
| IUPAC Name | 1-[(3,4-dichlorophenyl)methyl]-3-ethyl-1-methyl-2-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1nnc2n1CCCC2)N(C)Cc1ccc(Cl)c(Cl)c1.I |
| InChI | InChI=1S/C18H24Cl2N6.HI/c1-3-21-18(25(2)12-13-7-8-14(19)15(20)10-13)22-11-17-24-23-16-6-4-5-9-26(16)17;/h7-8,10H,3-6,9,11-12H2,1-2H3,(H,21,22);1H |
| InChIKey | NGCZTWYLAJWPRV-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 58.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.25 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|