C19H26Cl2N6 — CID 111306277
1-[(3,4-dichlorophenyl)methyl]-3-ethyl-1-methyl-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethyl)guanidine (PubChem CID 111306277) has the molecular formula C19H26Cl2N6 and a molecular weight of 409.37 g/mol. Its IUPAC name is 1-[(3,4-dichlorophenyl)methyl]-3-ethyl-1-methyl-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethyl)guanidine.
| Compound Name | 1-[(3,4-dichlorophenyl)methyl]-3-ethyl-1-methyl-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethyl)guanidine |
|---|---|
| PubChem CID | 111306277 |
| Molecular Formula | C19H26Cl2N6 |
| Molecular Weight | 409.37 g/mol |
| Exact Mass | 408.16 |
| IUPAC Name | 1-[(3,4-dichlorophenyl)methyl]-3-ethyl-1-methyl-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethyl)guanidine |
| SMILES | CCN/C(=N\Cc1nnc2n1CCCCC2)N(C)Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C19H26Cl2N6/c1-3-22-19(26(2)13-14-8-9-15(20)16(21)11-14)23-12-18-25-24-17-7-5-4-6-10-27(17)18/h8-9,11H,3-7,10,12-13H2,1-2H3,(H,22,23) |
| InChIKey | RYNDFKFMCFFWQD-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 58.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.37 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|