C17H23FN6 — CID 111285391
2-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-ylmethyl)-3-ethyl-1-[(3-fluorophenyl)methyl]-1-methylguanidine (PubChem CID 111285391) has the molecular formula C17H23FN6 and a molecular weight of 330.41 g/mol. Its IUPAC name is 2-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-ylmethyl)-3-ethyl-1-[(3-fluorophenyl)methyl]-1-methylguanidine.
| Compound Name | 2-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-ylmethyl)-3-ethyl-1-[(3-fluorophenyl)methyl]-1-methylguanidine |
|---|---|
| PubChem CID | 111285391 |
| Molecular Formula | C17H23FN6 |
| Molecular Weight | 330.41 g/mol |
| Exact Mass | 330.20 |
| IUPAC Name | 2-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-ylmethyl)-3-ethyl-1-[(3-fluorophenyl)methyl]-1-methylguanidine |
| SMILES | CCN/C(=N\Cc1nnc2n1CCC2)N(C)Cc1cccc(F)c1 |
| InChI | InChI=1S/C17H23FN6/c1-3-19-17(23(2)12-13-6-4-7-14(18)10-13)20-11-16-22-21-15-8-5-9-24(15)16/h4,6-7,10H,3,5,8-9,11-12H2,1-2H3,(H,19,20) |
| InChIKey | UGERGKGNFGRCET-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 58.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.41 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|