C20H28F3N5O2 — CID 111273007
3-ethyl-1-[(4-methoxyphenyl)methyl]-1-methyl-2-[4,4,4-trifluoro-3-hydroxy-3-(1-methylimidazol-2-yl)butyl]guanidine (PubChem CID 111273007) has the molecular formula C20H28F3N5O2 and a molecular weight of 427.47 g/mol. Its IUPAC name is 3-ethyl-1-[(4-methoxyphenyl)methyl]-1-methyl-2-[4,4,4-trifluoro-3-hydroxy-3-(1-methylimidazol-2-yl)butyl]guanidine.
| Compound Name | 3-ethyl-1-[(4-methoxyphenyl)methyl]-1-methyl-2-[4,4,4-trifluoro-3-hydroxy-3-(1-methylimidazol-2-yl)butyl]guanidine |
|---|---|
| PubChem CID | 111273007 |
| Molecular Formula | C20H28F3N5O2 |
| Molecular Weight | 427.47 g/mol |
| Exact Mass | 427.22 |
| IUPAC Name | 3-ethyl-1-[(4-methoxyphenyl)methyl]-1-methyl-2-[4,4,4-trifluoro-3-hydroxy-3-(1-methylimidazol-2-yl)butyl]guanidine |
| SMILES | CCN/C(=N\CCC(O)(c1nccn1C)C(F)(F)F)N(C)Cc1ccc(OC)cc1 |
| InChI | InChI=1S/C20H28F3N5O2/c1-5-24-18(28(3)14-15-6-8-16(30-4)9-7-15)26-11-10-19(29,20(21,22)23)17-25-12-13-27(17)2/h6-9,12-13,29H,5,10-11,14H2,1-4H3,(H,24,26) |
| InChIKey | CJQQZLPJZHXCQX-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 74.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.47 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|