C18H25F3IN5O2 — CID 110927089
1-[2-(4-methoxyphenyl)ethyl]-2-[4,4,4-trifluoro-3-hydroxy-3-(1-methylimidazol-2-yl)butyl]guanidine;hydroiodide (PubChem CID 110927089) has the molecular formula C18H25F3IN5O2 and a molecular weight of 527.33 g/mol. Its IUPAC name is 1-[2-(4-methoxyphenyl)ethyl]-2-[4,4,4-trifluoro-3-hydroxy-3-(1-methylimidazol-2-yl)butyl]guanidine;hydroiodide.
| Compound Name | 1-[2-(4-methoxyphenyl)ethyl]-2-[4,4,4-trifluoro-3-hydroxy-3-(1-methylimidazol-2-yl)butyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 110927089 |
| Molecular Formula | C18H25F3IN5O2 |
| Molecular Weight | 527.33 g/mol |
| Exact Mass | 527.10 |
| IUPAC Name | 1-[2-(4-methoxyphenyl)ethyl]-2-[4,4,4-trifluoro-3-hydroxy-3-(1-methylimidazol-2-yl)butyl]guanidine;hydroiodide |
| SMILES | COc1ccc(CCN/C(N)=N/CCC(O)(c2nccn2C)C(F)(F)F)cc1.I |
| InChI | InChI=1S/C18H24F3N5O2.HI/c1-26-12-11-23-15(26)17(27,18(19,20)21)8-10-25-16(22)24-9-7-13-3-5-14(28-2)6-4-13;/h3-6,11-12,27H,7-10H2,1-2H3,(H3,22,24,25);1H |
| InChIKey | OFUAWYMITZULFN-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 97.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.33 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|