C18H25F3IN5O3 — CID 111046706
2-[(3,4-dimethoxyphenyl)methyl]-1-[4,4,4-trifluoro-3-hydroxy-3-(1-methylimidazol-2-yl)butyl]guanidine;hydroiodide (PubChem CID 111046706) has the molecular formula C18H25F3IN5O3 and a molecular weight of 543.33 g/mol. Its IUPAC name is 2-[(3,4-dimethoxyphenyl)methyl]-1-[4,4,4-trifluoro-3-hydroxy-3-(1-methylimidazol-2-yl)butyl]guanidine;hydroiodide.
| Compound Name | 2-[(3,4-dimethoxyphenyl)methyl]-1-[4,4,4-trifluoro-3-hydroxy-3-(1-methylimidazol-2-yl)butyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111046706 |
| Molecular Formula | C18H25F3IN5O3 |
| Molecular Weight | 543.33 g/mol |
| Exact Mass | 543.10 |
| IUPAC Name | 2-[(3,4-dimethoxyphenyl)methyl]-1-[4,4,4-trifluoro-3-hydroxy-3-(1-methylimidazol-2-yl)butyl]guanidine;hydroiodide |
| SMILES | COc1ccc(C/N=C(\N)NCCC(O)(c2nccn2C)C(F)(F)F)cc1OC.I |
| InChI | InChI=1S/C18H24F3N5O3.HI/c1-26-9-8-23-15(26)17(27,18(19,20)21)6-7-24-16(22)25-11-12-4-5-13(28-2)14(10-12)29-3;/h4-5,8-10,27H,6-7,11H2,1-3H3,(H3,22,24,25);1H |
| InChIKey | ZIPQSGZNFOSITG-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 106.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.33 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|