C16H20F3N3O2 — CID 110906421
1,1,1-trifluoro-4-[(2-methoxyphenyl)methylamino]-2-(1-methylimidazol-2-yl)butan-2-ol (PubChem CID 110906421) has the molecular formula C16H20F3N3O2 and a molecular weight of 343.35 g/mol. Its IUPAC name is 1,1,1-trifluoro-4-[(2-methoxyphenyl)methylamino]-2-(1-methylimidazol-2-yl)butan-2-ol.
| Compound Name | 1,1,1-trifluoro-4-[(2-methoxyphenyl)methylamino]-2-(1-methylimidazol-2-yl)butan-2-ol |
|---|---|
| PubChem CID | 110906421 |
| Molecular Formula | C16H20F3N3O2 |
| Molecular Weight | 343.35 g/mol |
| Exact Mass | 343.15 |
| IUPAC Name | 1,1,1-trifluoro-4-[(2-methoxyphenyl)methylamino]-2-(1-methylimidazol-2-yl)butan-2-ol |
| SMILES | COc1ccccc1CNCCC(O)(c1nccn1C)C(F)(F)F |
| InChI | InChI=1S/C16H20F3N3O2/c1-22-10-9-21-14(22)15(23,16(17,18)19)7-8-20-11-12-5-3-4-6-13(12)24-2/h3-6,9-10,20,23H,7-8,11H2,1-2H3 |
| InChIKey | YQCZEFVVSLTLCO-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.35 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|