C13H18F3N5O — CID 110929309
1,1,1-trifluoro-2-(1-methylimidazol-2-yl)-4-[(1-methylpyrazol-4-yl)methylamino]butan-2-ol (PubChem CID 110929309) has the molecular formula C13H18F3N5O and a molecular weight of 317.31 g/mol. Its IUPAC name is 1,1,1-trifluoro-2-(1-methylimidazol-2-yl)-4-[(1-methylpyrazol-4-yl)methylamino]butan-2-ol.
| Compound Name | 1,1,1-trifluoro-2-(1-methylimidazol-2-yl)-4-[(1-methylpyrazol-4-yl)methylamino]butan-2-ol |
|---|---|
| PubChem CID | 110929309 |
| Molecular Formula | C13H18F3N5O |
| Molecular Weight | 317.31 g/mol |
| Exact Mass | 317.15 |
| IUPAC Name | 1,1,1-trifluoro-2-(1-methylimidazol-2-yl)-4-[(1-methylpyrazol-4-yl)methylamino]butan-2-ol |
| SMILES | Cn1cc(CNCCC(O)(c2nccn2C)C(F)(F)F)cn1 |
| InChI | InChI=1S/C13H18F3N5O/c1-20-6-5-18-11(20)12(22,13(14,15)16)3-4-17-7-10-8-19-21(2)9-10/h5-6,8-9,17,22H,3-4,7H2,1-2H3 |
| InChIKey | CJDBWZRICGYKJV-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 67.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.31 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|