C18H21ClF3N5O — CID 47075614
1,1,1-trifluoro-2-(1-methylimidazol-2-yl)-4-[(4-pyrazol-1-ylphenyl)methylamino]butan-2-ol;hydrochloride (PubChem CID 47075614) has the molecular formula C18H21ClF3N5O and a molecular weight of 415.85 g/mol. Its IUPAC name is 1,1,1-trifluoro-2-(1-methylimidazol-2-yl)-4-[(4-pyrazol-1-ylphenyl)methylamino]butan-2-ol;hydrochloride.
| Compound Name | 1,1,1-trifluoro-2-(1-methylimidazol-2-yl)-4-[(4-pyrazol-1-ylphenyl)methylamino]butan-2-ol;hydrochloride |
|---|---|
| PubChem CID | 47075614 |
| Molecular Formula | C18H21ClF3N5O |
| Molecular Weight | 415.85 g/mol |
| Exact Mass | 415.14 |
| IUPAC Name | 1,1,1-trifluoro-2-(1-methylimidazol-2-yl)-4-[(4-pyrazol-1-ylphenyl)methylamino]butan-2-ol;hydrochloride |
| SMILES | Cl.Cn1ccnc1C(O)(CCNCc1ccc(-n2cccn2)cc1)C(F)(F)F |
| InChI | InChI=1S/C18H20F3N5O.ClH/c1-25-12-10-23-16(25)17(27,18(19,20)21)7-9-22-13-14-3-5-15(6-4-14)26-11-2-8-24-26;/h2-6,8,10-12,22,27H,7,9,13H2,1H3;1H |
| InChIKey | WHMVDSBSCKLYJK-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 67.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.85 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|