C11H19F3IN5O — CID 119118319
1,1-dimethyl-2-[4,4,4-trifluoro-3-hydroxy-3-(1-methylimidazol-2-yl)butyl]guanidine;hydroiodide (PubChem CID 119118319) has the molecular formula C11H19F3IN5O and a molecular weight of 421.21 g/mol. Its IUPAC name is 1,1-dimethyl-2-[4,4,4-trifluoro-3-hydroxy-3-(1-methylimidazol-2-yl)butyl]guanidine;hydroiodide.
| Compound Name | 1,1-dimethyl-2-[4,4,4-trifluoro-3-hydroxy-3-(1-methylimidazol-2-yl)butyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 119118319 |
| Molecular Formula | C11H19F3IN5O |
| Molecular Weight | 421.21 g/mol |
| Exact Mass | 421.06 |
| IUPAC Name | 1,1-dimethyl-2-[4,4,4-trifluoro-3-hydroxy-3-(1-methylimidazol-2-yl)butyl]guanidine;hydroiodide |
| SMILES | CN(C)/C(N)=N/CCC(O)(c1nccn1C)C(F)(F)F.I |
| InChI | InChI=1S/C11H18F3N5O.HI/c1-18(2)9(15)17-5-4-10(20,11(12,13)14)8-16-6-7-19(8)3;/h6-7,20H,4-5H2,1-3H3,(H2,15,17);1H |
| InChIKey | MPLHGILBUOIEHA-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 79.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.21 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|