C18H30F3IN6O3 — CID 111046704
tert-butyl 4-[N'-[4,4,4-trifluoro-3-hydroxy-3-(1-methylimidazol-2-yl)butyl]carbamimidoyl]piperazine-1-carboxylate;hydroiodide (PubChem CID 111046704) has the molecular formula C18H30F3IN6O3 and a molecular weight of 562.38 g/mol. Its IUPAC name is tert-butyl 4-[N'-[4,4,4-trifluoro-3-hydroxy-3-(1-methylimidazol-2-yl)butyl]carbamimidoyl]piperazine-1-carboxylate;hydroiodide.
| Compound Name | tert-butyl 4-[N'-[4,4,4-trifluoro-3-hydroxy-3-(1-methylimidazol-2-yl)butyl]carbamimidoyl]piperazine-1-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 111046704 |
| Molecular Formula | C18H30F3IN6O3 |
| Molecular Weight | 562.38 g/mol |
| Exact Mass | 562.14 |
| IUPAC Name | tert-butyl 4-[N'-[4,4,4-trifluoro-3-hydroxy-3-(1-methylimidazol-2-yl)butyl]carbamimidoyl]piperazine-1-carboxylate;hydroiodide |
| SMILES | Cn1ccnc1C(O)(CC/N=C(\N)N1CCN(C(=O)OC(C)(C)C)CC1)C(F)(F)F.I |
| InChI | InChI=1S/C18H29F3N6O3.HI/c1-16(2,3)30-15(28)27-11-9-26(10-12-27)14(22)24-6-5-17(29,18(19,20)21)13-23-7-8-25(13)4;/h7-8,29H,5-6,9-12H2,1-4H3,(H2,22,24);1H |
| InChIKey | FLHRKPFUTFVJFR-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 109.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.38 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|