C15H24F3N5O — CID 111046693
3-methyl-N'-[4,4,4-trifluoro-3-hydroxy-3-(1-methylimidazol-2-yl)butyl]piperidine-1-carboximidamide (PubChem CID 111046693) has the molecular formula C15H24F3N5O and a molecular weight of 347.39 g/mol. Its IUPAC name is 3-methyl-N'-[4,4,4-trifluoro-3-hydroxy-3-(1-methylimidazol-2-yl)butyl]piperidine-1-carboximidamide.
| Compound Name | 3-methyl-N'-[4,4,4-trifluoro-3-hydroxy-3-(1-methylimidazol-2-yl)butyl]piperidine-1-carboximidamide |
|---|---|
| PubChem CID | 111046693 |
| Molecular Formula | C15H24F3N5O |
| Molecular Weight | 347.39 g/mol |
| Exact Mass | 347.19 |
| IUPAC Name | 3-methyl-N'-[4,4,4-trifluoro-3-hydroxy-3-(1-methylimidazol-2-yl)butyl]piperidine-1-carboximidamide |
| SMILES | CC1CCCN(/C(N)=N/CCC(O)(c2nccn2C)C(F)(F)F)C1 |
| InChI | InChI=1S/C15H24F3N5O/c1-11-4-3-8-23(10-11)13(19)21-6-5-14(24,15(16,17)18)12-20-7-9-22(12)2/h7,9,11,24H,3-6,8,10H2,1-2H3,(H2,19,21) |
| InChIKey | UIEAHHXURYIEAI-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 79.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.39 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|