C19H33F3N6O — CID 111020017
1-ethyl-3-(1-propylpiperidin-4-yl)-2-[4,4,4-trifluoro-3-hydroxy-3-(1-methylimidazol-2-yl)butyl]guanidine (PubChem CID 111020017) has the molecular formula C19H33F3N6O and a molecular weight of 418.51 g/mol. Its IUPAC name is 1-ethyl-3-(1-propylpiperidin-4-yl)-2-[4,4,4-trifluoro-3-hydroxy-3-(1-methylimidazol-2-yl)butyl]guanidine.
| Compound Name | 1-ethyl-3-(1-propylpiperidin-4-yl)-2-[4,4,4-trifluoro-3-hydroxy-3-(1-methylimidazol-2-yl)butyl]guanidine |
|---|---|
| PubChem CID | 111020017 |
| Molecular Formula | C19H33F3N6O |
| Molecular Weight | 418.51 g/mol |
| Exact Mass | 418.27 |
| IUPAC Name | 1-ethyl-3-(1-propylpiperidin-4-yl)-2-[4,4,4-trifluoro-3-hydroxy-3-(1-methylimidazol-2-yl)butyl]guanidine |
| SMILES | CCCN1CCC(N/C(=N/CCC(O)(c2nccn2C)C(F)(F)F)NCC)CC1 |
| InChI | InChI=1S/C19H33F3N6O/c1-4-11-28-12-6-15(7-13-28)26-17(23-5-2)25-9-8-18(29,19(20,21)22)16-24-10-14-27(16)3/h10,14-15,29H,4-9,11-13H2,1-3H3,(H2,23,25,26) |
| InChIKey | SUACKTUHNWIGSR-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 77.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.51 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|