C20H35F3IN5O — CID 111985492
1-ethyl-2-[2-(3-methylcyclohexyl)ethyl]-3-[4,4,4-trifluoro-3-hydroxy-3-(1-methylimidazol-2-yl)butyl]guanidine;hydroiodide (PubChem CID 111985492) has the molecular formula C20H35F3IN5O and a molecular weight of 545.43 g/mol. Its IUPAC name is 1-ethyl-2-[2-(3-methylcyclohexyl)ethyl]-3-[4,4,4-trifluoro-3-hydroxy-3-(1-methylimidazol-2-yl)butyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[2-(3-methylcyclohexyl)ethyl]-3-[4,4,4-trifluoro-3-hydroxy-3-(1-methylimidazol-2-yl)butyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111985492 |
| Molecular Formula | C20H35F3IN5O |
| Molecular Weight | 545.43 g/mol |
| Exact Mass | 545.18 |
| IUPAC Name | 1-ethyl-2-[2-(3-methylcyclohexyl)ethyl]-3-[4,4,4-trifluoro-3-hydroxy-3-(1-methylimidazol-2-yl)butyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCC1CCCC(C)C1)NCCC(O)(c1nccn1C)C(F)(F)F.I |
| InChI | InChI=1S/C20H34F3N5O.HI/c1-4-24-18(26-10-8-16-7-5-6-15(2)14-16)27-11-9-19(29,20(21,22)23)17-25-12-13-28(17)3;/h12-13,15-16,29H,4-11,14H2,1-3H3,(H2,24,26,27);1H |
| InChIKey | QXCBFZZIYJHGAZ-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 74.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.43 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|