C21H31F3IN5O — CID 111988152
1-[2-(3,5-dimethylphenyl)ethyl]-3-ethyl-2-[4,4,4-trifluoro-3-hydroxy-3-(1-methylimidazol-2-yl)butyl]guanidine;hydroiodide (PubChem CID 111988152) has the molecular formula C21H31F3IN5O and a molecular weight of 553.41 g/mol. Its IUPAC name is 1-[2-(3,5-dimethylphenyl)ethyl]-3-ethyl-2-[4,4,4-trifluoro-3-hydroxy-3-(1-methylimidazol-2-yl)butyl]guanidine;hydroiodide.
| Compound Name | 1-[2-(3,5-dimethylphenyl)ethyl]-3-ethyl-2-[4,4,4-trifluoro-3-hydroxy-3-(1-methylimidazol-2-yl)butyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111988152 |
| Molecular Formula | C21H31F3IN5O |
| Molecular Weight | 553.41 g/mol |
| Exact Mass | 553.15 |
| IUPAC Name | 1-[2-(3,5-dimethylphenyl)ethyl]-3-ethyl-2-[4,4,4-trifluoro-3-hydroxy-3-(1-methylimidazol-2-yl)butyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCC(O)(c1nccn1C)C(F)(F)F)NCCc1cc(C)cc(C)c1.I |
| InChI | InChI=1S/C21H30F3N5O.HI/c1-5-25-19(27-8-6-17-13-15(2)12-16(3)14-17)28-9-7-20(30,21(22,23)24)18-26-10-11-29(18)4;/h10-14,30H,5-9H2,1-4H3,(H2,25,27,28);1H |
| InChIKey | YHDKDPFRTNGFNX-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 74.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.41 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|