C19H26ClF3IN5O — CID 111197439
1-[2-(4-chlorophenyl)ethyl]-3-ethyl-2-[4,4,4-trifluoro-3-hydroxy-3-(1-methylimidazol-2-yl)butyl]guanidine;hydroiodide (PubChem CID 111197439) has the molecular formula C19H26ClF3IN5O and a molecular weight of 559.80 g/mol. Its IUPAC name is 1-[2-(4-chlorophenyl)ethyl]-3-ethyl-2-[4,4,4-trifluoro-3-hydroxy-3-(1-methylimidazol-2-yl)butyl]guanidine;hydroiodide.
| Compound Name | 1-[2-(4-chlorophenyl)ethyl]-3-ethyl-2-[4,4,4-trifluoro-3-hydroxy-3-(1-methylimidazol-2-yl)butyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111197439 |
| Molecular Formula | C19H26ClF3IN5O |
| Molecular Weight | 559.80 g/mol |
| Exact Mass | 559.08 |
| IUPAC Name | 1-[2-(4-chlorophenyl)ethyl]-3-ethyl-2-[4,4,4-trifluoro-3-hydroxy-3-(1-methylimidazol-2-yl)butyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCC(O)(c1nccn1C)C(F)(F)F)NCCc1ccc(Cl)cc1.I |
| InChI | InChI=1S/C19H25ClF3N5O.HI/c1-3-24-17(26-10-8-14-4-6-15(20)7-5-14)27-11-9-18(29,19(21,22)23)16-25-12-13-28(16)2;/h4-7,12-13,29H,3,8-11H2,1-2H3,(H2,24,26,27);1H |
| InChIKey | IXWJROAMXDVCAQ-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 74.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.80 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|