C19H26F3N5O2 — CID 111182494
1-ethyl-2-[(4-methoxyphenyl)methyl]-3-[4,4,4-trifluoro-3-hydroxy-3-(1-methylimidazol-2-yl)butyl]guanidine (PubChem CID 111182494) has the molecular formula C19H26F3N5O2 and a molecular weight of 413.44 g/mol. Its IUPAC name is 1-ethyl-2-[(4-methoxyphenyl)methyl]-3-[4,4,4-trifluoro-3-hydroxy-3-(1-methylimidazol-2-yl)butyl]guanidine.
| Compound Name | 1-ethyl-2-[(4-methoxyphenyl)methyl]-3-[4,4,4-trifluoro-3-hydroxy-3-(1-methylimidazol-2-yl)butyl]guanidine |
|---|---|
| PubChem CID | 111182494 |
| Molecular Formula | C19H26F3N5O2 |
| Molecular Weight | 413.44 g/mol |
| Exact Mass | 413.20 |
| IUPAC Name | 1-ethyl-2-[(4-methoxyphenyl)methyl]-3-[4,4,4-trifluoro-3-hydroxy-3-(1-methylimidazol-2-yl)butyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccc(OC)cc1)NCCC(O)(c1nccn1C)C(F)(F)F |
| InChI | InChI=1S/C19H26F3N5O2/c1-4-23-17(26-13-14-5-7-15(29-3)8-6-14)25-10-9-18(28,19(20,21)22)16-24-11-12-27(16)2/h5-8,11-12,28H,4,9-10,13H2,1-3H3,(H2,23,25,26) |
| InChIKey | TZUCRGXGBIGDLV-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 83.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.44 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|