C21H28F3N5O — CID 111992473
N-ethyl-3-phenyl-N'-[4,4,4-trifluoro-3-hydroxy-3-(1-methylimidazol-2-yl)butyl]pyrrolidine-1-carboximidamide (PubChem CID 111992473) has the molecular formula C21H28F3N5O and a molecular weight of 423.48 g/mol. Its IUPAC name is N-ethyl-3-phenyl-N'-[4,4,4-trifluoro-3-hydroxy-3-(1-methylimidazol-2-yl)butyl]pyrrolidine-1-carboximidamide.
| Compound Name | N-ethyl-3-phenyl-N'-[4,4,4-trifluoro-3-hydroxy-3-(1-methylimidazol-2-yl)butyl]pyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 111992473 |
| Molecular Formula | C21H28F3N5O |
| Molecular Weight | 423.48 g/mol |
| Exact Mass | 423.22 |
| IUPAC Name | N-ethyl-3-phenyl-N'-[4,4,4-trifluoro-3-hydroxy-3-(1-methylimidazol-2-yl)butyl]pyrrolidine-1-carboximidamide |
| SMILES | CCN/C(=N\CCC(O)(c1nccn1C)C(F)(F)F)N1CCC(c2ccccc2)C1 |
| InChI | InChI=1S/C21H28F3N5O/c1-3-25-19(29-13-9-17(15-29)16-7-5-4-6-8-16)27-11-10-20(30,21(22,23)24)18-26-12-14-28(18)2/h4-8,12,14,17,30H,3,9-11,13,15H2,1-2H3,(H,25,27) |
| InChIKey | AZULQNHORWXSCZ-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 65.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.48 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|