C16H18F3N5 — CID 122099159
1-(3-propan-2-ylphenyl)-2-[[4-(trifluoromethyl)pyrimidin-2-yl]methyl]guanidine (PubChem CID 122099159) has the molecular formula C16H18F3N5 and a molecular weight of 337.35 g/mol. Its IUPAC name is 1-(3-propan-2-ylphenyl)-2-[[4-(trifluoromethyl)pyrimidin-2-yl]methyl]guanidine.
| Compound Name | 1-(3-propan-2-ylphenyl)-2-[[4-(trifluoromethyl)pyrimidin-2-yl]methyl]guanidine |
|---|---|
| PubChem CID | 122099159 |
| Molecular Formula | C16H18F3N5 |
| Molecular Weight | 337.35 g/mol |
| Exact Mass | 337.15 |
| IUPAC Name | 1-(3-propan-2-ylphenyl)-2-[[4-(trifluoromethyl)pyrimidin-2-yl]methyl]guanidine |
| SMILES | CC(C)c1cccc(N/C(N)=N/Cc2nccc(C(F)(F)F)n2)c1 |
| InChI | InChI=1S/C16H18F3N5/c1-10(2)11-4-3-5-12(8-11)23-15(20)22-9-14-21-7-6-13(24-14)16(17,18)19/h3-8,10H,9H2,1-2H3,(H3,20,22,23) |
| InChIKey | NNNRJRXKTKOKCQ-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 76.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.35 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|