C11H16F3N5 — CID 122099170
1-tert-butyl-2-[[4-(trifluoromethyl)pyrimidin-2-yl]methyl]guanidine (PubChem CID 122099170) has the molecular formula C11H16F3N5 and a molecular weight of 275.28 g/mol. Its IUPAC name is 1-tert-butyl-2-[[4-(trifluoromethyl)pyrimidin-2-yl]methyl]guanidine.
| Compound Name | 1-tert-butyl-2-[[4-(trifluoromethyl)pyrimidin-2-yl]methyl]guanidine |
|---|---|
| PubChem CID | 122099170 |
| Molecular Formula | C11H16F3N5 |
| Molecular Weight | 275.28 g/mol |
| Exact Mass | 275.14 |
| IUPAC Name | 1-tert-butyl-2-[[4-(trifluoromethyl)pyrimidin-2-yl]methyl]guanidine |
| SMILES | CC(C)(C)N/C(N)=N/Cc1nccc(C(F)(F)F)n1 |
| InChI | InChI=1S/C11H16F3N5/c1-10(2,3)19-9(15)17-6-8-16-5-4-7(18-8)11(12,13)14/h4-5H,6H2,1-3H3,(H3,15,17,19) |
| InChIKey | OCRQBJVFDLFCBQ-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 76.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.28 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|