C12H18F2N4O — CID 120913636
1-tert-butyl-2-[[2-(difluoromethoxy)-4-pyridinyl]methyl]guanidine (PubChem CID 120913636) has the molecular formula C12H18F2N4O and a molecular weight of 272.30 g/mol. Its IUPAC name is 1-tert-butyl-2-[[2-(difluoromethoxy)-4-pyridinyl]methyl]guanidine.
| Compound Name | 1-tert-butyl-2-[[2-(difluoromethoxy)-4-pyridinyl]methyl]guanidine |
|---|---|
| PubChem CID | 120913636 |
| Molecular Formula | C12H18F2N4O |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.14 |
| IUPAC Name | 1-tert-butyl-2-[[2-(difluoromethoxy)-4-pyridinyl]methyl]guanidine |
| SMILES | CC(C)(C)N/C(N)=N/Cc1ccnc(OC(F)F)c1 |
| InChI | InChI=1S/C12H18F2N4O/c1-12(2,3)18-11(15)17-7-8-4-5-16-9(6-8)19-10(13)14/h4-6,10H,7H2,1-3H3,(H3,15,17,18) |
| InChIKey | VNKYKUIIOOASBG-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 72.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|