C15H16ClF3N6O — CID 111800908
1-(3-chloro-4-methoxyphenyl)-2-[2-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]ethyl]guanidine (PubChem CID 111800908) has the molecular formula C15H16ClF3N6O and a molecular weight of 388.78 g/mol. Its IUPAC name is 1-(3-chloro-4-methoxyphenyl)-2-[2-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]ethyl]guanidine.
| Compound Name | 1-(3-chloro-4-methoxyphenyl)-2-[2-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]ethyl]guanidine |
|---|---|
| PubChem CID | 111800908 |
| Molecular Formula | C15H16ClF3N6O |
| Molecular Weight | 388.78 g/mol |
| Exact Mass | 388.10 |
| IUPAC Name | 1-(3-chloro-4-methoxyphenyl)-2-[2-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]ethyl]guanidine |
| SMILES | COc1ccc(N/C(N)=N/CCNc2nccc(C(F)(F)F)n2)cc1Cl |
| InChI | InChI=1S/C15H16ClF3N6O/c1-26-11-3-2-9(8-10(11)16)24-13(20)21-6-7-23-14-22-5-4-12(25-14)15(17,18)19/h2-5,8H,6-7H2,1H3,(H3,20,21,24)(H,22,23,25) |
| InChIKey | NJKDDSXZFGMKCP-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 97.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.78 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|