C15H14F6N6O — CID 111800902
1-[4-(trifluoromethoxy)phenyl]-2-[2-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]ethyl]guanidine (PubChem CID 111800902) has the molecular formula C15H14F6N6O and a molecular weight of 408.31 g/mol. Its IUPAC name is 1-[4-(trifluoromethoxy)phenyl]-2-[2-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]ethyl]guanidine.
| Compound Name | 1-[4-(trifluoromethoxy)phenyl]-2-[2-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]ethyl]guanidine |
|---|---|
| PubChem CID | 111800902 |
| Molecular Formula | C15H14F6N6O |
| Molecular Weight | 408.31 g/mol |
| Exact Mass | 408.11 |
| IUPAC Name | 1-[4-(trifluoromethoxy)phenyl]-2-[2-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]ethyl]guanidine |
| SMILES | N/C(=N\CCNc1nccc(C(F)(F)F)n1)Nc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C15H14F6N6O/c16-14(17,18)11-5-6-24-13(27-11)25-8-7-23-12(22)26-9-1-3-10(4-2-9)28-15(19,20)21/h1-6H,7-8H2,(H3,22,23,26)(H,24,25,27) |
| InChIKey | MLIBIYUBLVBBEM-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 97.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.31 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|