C16H21F3IN5O — CID 111817871
2-[4-(2-methylimidazol-1-yl)butyl]-1-[4-(trifluoromethoxy)phenyl]guanidine;hydroiodide (PubChem CID 111817871) has the molecular formula C16H21F3IN5O and a molecular weight of 483.28 g/mol. Its IUPAC name is 2-[4-(2-methylimidazol-1-yl)butyl]-1-[4-(trifluoromethoxy)phenyl]guanidine;hydroiodide.
| Compound Name | 2-[4-(2-methylimidazol-1-yl)butyl]-1-[4-(trifluoromethoxy)phenyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111817871 |
| Molecular Formula | C16H21F3IN5O |
| Molecular Weight | 483.28 g/mol |
| Exact Mass | 483.07 |
| IUPAC Name | 2-[4-(2-methylimidazol-1-yl)butyl]-1-[4-(trifluoromethoxy)phenyl]guanidine;hydroiodide |
| SMILES | Cc1nccn1CCCC/N=C(\N)Nc1ccc(OC(F)(F)F)cc1.I |
| InChI | InChI=1S/C16H20F3N5O.HI/c1-12-21-9-11-24(12)10-3-2-8-22-15(20)23-13-4-6-14(7-5-13)25-16(17,18)19;/h4-7,9,11H,2-3,8,10H2,1H3,(H3,20,22,23);1H |
| InChIKey | MNJGFEHUDOROLG-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 77.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.28 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|