C18H19Cl2FN4O — CID 138997614
N-[2-[[amino-[1-(2,4-dichlorophenyl)ethylamino]methylidene]amino]ethyl]-4-fluorobenzamide (PubChem CID 138997614) has the molecular formula C18H19Cl2FN4O and a molecular weight of 397.28 g/mol. Its IUPAC name is N-[2-[[amino-[1-(2,4-dichlorophenyl)ethylamino]methylidene]amino]ethyl]-4-fluorobenzamide.
| Compound Name | N-[2-[[amino-[1-(2,4-dichlorophenyl)ethylamino]methylidene]amino]ethyl]-4-fluorobenzamide |
|---|---|
| PubChem CID | 138997614 |
| Molecular Formula | C18H19Cl2FN4O |
| Molecular Weight | 397.28 g/mol |
| Exact Mass | 396.09 |
| IUPAC Name | N-[2-[[amino-[1-(2,4-dichlorophenyl)ethylamino]methylidene]amino]ethyl]-4-fluorobenzamide |
| SMILES | CC(N/C(N)=N/CCNC(=O)c1ccc(F)cc1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C18H19Cl2FN4O/c1-11(15-7-4-13(19)10-16(15)20)25-18(22)24-9-8-23-17(26)12-2-5-14(21)6-3-12/h2-7,10-11H,8-9H2,1H3,(H,23,26)(H3,22,24,25) |
| InChIKey | ITYMFZDSJCJQNH-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 79.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.28 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|