C14H24F3IN6O — CID 111773979
1-ethyl-3-(1-methoxypropan-2-yl)-2-[2-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]ethyl]guanidine;hydroiodide (PubChem CID 111773979) has the molecular formula C14H24F3IN6O and a molecular weight of 476.29 g/mol. Its IUPAC name is 1-ethyl-3-(1-methoxypropan-2-yl)-2-[2-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]ethyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-(1-methoxypropan-2-yl)-2-[2-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111773979 |
| Molecular Formula | C14H24F3IN6O |
| Molecular Weight | 476.29 g/mol |
| Exact Mass | 476.10 |
| IUPAC Name | 1-ethyl-3-(1-methoxypropan-2-yl)-2-[2-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]ethyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCNc1nccc(C(F)(F)F)n1)NC(C)COC.I |
| InChI | InChI=1S/C14H23F3N6O.HI/c1-4-18-12(22-10(2)9-24-3)20-7-8-21-13-19-6-5-11(23-13)14(15,16)17;/h5-6,10H,4,7-9H2,1-3H3,(H2,18,20,22)(H,19,21,23);1H |
| InChIKey | XHIODRRITZLEFN-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 83.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.29 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|