C19H34F3N7 — CID 111771466
1-[5-(diethylamino)pentan-2-yl]-3-ethyl-2-[2-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]ethyl]guanidine (PubChem CID 111771466) has the molecular formula C19H34F3N7 and a molecular weight of 417.52 g/mol. Its IUPAC name is 1-[5-(diethylamino)pentan-2-yl]-3-ethyl-2-[2-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]ethyl]guanidine.
| Compound Name | 1-[5-(diethylamino)pentan-2-yl]-3-ethyl-2-[2-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]ethyl]guanidine |
|---|---|
| PubChem CID | 111771466 |
| Molecular Formula | C19H34F3N7 |
| Molecular Weight | 417.52 g/mol |
| Exact Mass | 417.28 |
| IUPAC Name | 1-[5-(diethylamino)pentan-2-yl]-3-ethyl-2-[2-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]ethyl]guanidine |
| SMILES | CCN/C(=N\CCNc1nccc(C(F)(F)F)n1)NC(C)CCCN(CC)CC |
| InChI | InChI=1S/C19H34F3N7/c1-5-23-17(27-15(4)9-8-14-29(6-2)7-3)25-12-13-26-18-24-11-10-16(28-18)19(20,21)22/h10-11,15H,5-9,12-14H2,1-4H3,(H2,23,25,27)(H,24,26,28) |
| InChIKey | ODKLUALJYBHNSS-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 77.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.52 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|