C22H37F3N4O2 — CID 110997573
1-[5-(diethylamino)pentan-2-yl]-3-ethyl-2-[[3-methoxy-4-(2,2,2-trifluoroethoxy)phenyl]methyl]guanidine (PubChem CID 110997573) has the molecular formula C22H37F3N4O2 and a molecular weight of 446.56 g/mol. Its IUPAC name is 1-[5-(diethylamino)pentan-2-yl]-3-ethyl-2-[[3-methoxy-4-(2,2,2-trifluoroethoxy)phenyl]methyl]guanidine.
| Compound Name | 1-[5-(diethylamino)pentan-2-yl]-3-ethyl-2-[[3-methoxy-4-(2,2,2-trifluoroethoxy)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 110997573 |
| Molecular Formula | C22H37F3N4O2 |
| Molecular Weight | 446.56 g/mol |
| Exact Mass | 446.29 |
| IUPAC Name | 1-[5-(diethylamino)pentan-2-yl]-3-ethyl-2-[[3-methoxy-4-(2,2,2-trifluoroethoxy)phenyl]methyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccc(OCC(F)(F)F)c(OC)c1)NC(C)CCCN(CC)CC |
| InChI | InChI=1S/C22H37F3N4O2/c1-6-26-21(28-17(4)10-9-13-29(7-2)8-3)27-15-18-11-12-19(20(14-18)30-5)31-16-22(23,24)25/h11-12,14,17H,6-10,13,15-16H2,1-5H3,(H2,26,27,28) |
| InChIKey | ABZVHLOJIWLRBQ-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.56 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|