C20H33F3IN3O3 — CID 111713258
1-ethyl-3-[2-(2-hydroxyethyl)pentyl]-2-[[3-methoxy-4-(2,2,2-trifluoroethoxy)phenyl]methyl]guanidine;hydroiodide (PubChem CID 111713258) has the molecular formula C20H33F3IN3O3 and a molecular weight of 547.40 g/mol. Its IUPAC name is 1-ethyl-3-[2-(2-hydroxyethyl)pentyl]-2-[[3-methoxy-4-(2,2,2-trifluoroethoxy)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-[2-(2-hydroxyethyl)pentyl]-2-[[3-methoxy-4-(2,2,2-trifluoroethoxy)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111713258 |
| Molecular Formula | C20H33F3IN3O3 |
| Molecular Weight | 547.40 g/mol |
| Exact Mass | 547.15 |
| IUPAC Name | 1-ethyl-3-[2-(2-hydroxyethyl)pentyl]-2-[[3-methoxy-4-(2,2,2-trifluoroethoxy)phenyl]methyl]guanidine;hydroiodide |
| SMILES | CCCC(CCO)CN/C(=N/Cc1ccc(OCC(F)(F)F)c(OC)c1)NCC.I |
| InChI | InChI=1S/C20H32F3N3O3.HI/c1-4-6-15(9-10-27)12-25-19(24-5-2)26-13-16-7-8-17(18(11-16)28-3)29-14-20(21,22)23;/h7-8,11,15,27H,4-6,9-10,12-14H2,1-3H3,(H2,24,25,26);1H |
| InChIKey | NPXFFHLXTQJUHC-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.40 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|