C19H35N5O2 — CID 110999019
N-[2-[[[5-(diethylamino)pentan-2-ylamino]-(ethylamino)methylidene]amino]ethyl]furan-2-carboxamide (PubChem CID 110999019) has the molecular formula C19H35N5O2 and a molecular weight of 365.52 g/mol. Its IUPAC name is N-[2-[[[5-(diethylamino)pentan-2-ylamino]-(ethylamino)methylidene]amino]ethyl]furan-2-carboxamide.
| Compound Name | N-[2-[[[5-(diethylamino)pentan-2-ylamino]-(ethylamino)methylidene]amino]ethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 110999019 |
| Molecular Formula | C19H35N5O2 |
| Molecular Weight | 365.52 g/mol |
| Exact Mass | 365.28 |
| IUPAC Name | N-[2-[[[5-(diethylamino)pentan-2-ylamino]-(ethylamino)methylidene]amino]ethyl]furan-2-carboxamide |
| SMILES | CCN/C(=N\CCNC(=O)c1ccco1)NC(C)CCCN(CC)CC |
| InChI | InChI=1S/C19H35N5O2/c1-5-20-19(23-16(4)10-8-14-24(6-2)7-3)22-13-12-21-18(25)17-11-9-15-26-17/h9,11,15-16H,5-8,10,12-14H2,1-4H3,(H,21,25)(H2,20,22,23) |
| InChIKey | ZTDLSJDQZDGDPZ-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 81.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.52 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|