C22H39N5O — CID 110998809
N-benzyl-3-[[[5-(diethylamino)pentan-2-ylamino]-(ethylamino)methylidene]amino]propanamide (PubChem CID 110998809) has the molecular formula C22H39N5O and a molecular weight of 389.59 g/mol. Its IUPAC name is N-benzyl-3-[[[5-(diethylamino)pentan-2-ylamino]-(ethylamino)methylidene]amino]propanamide.
| Compound Name | N-benzyl-3-[[[5-(diethylamino)pentan-2-ylamino]-(ethylamino)methylidene]amino]propanamide |
|---|---|
| PubChem CID | 110998809 |
| Molecular Formula | C22H39N5O |
| Molecular Weight | 389.59 g/mol |
| Exact Mass | 389.32 |
| IUPAC Name | N-benzyl-3-[[[5-(diethylamino)pentan-2-ylamino]-(ethylamino)methylidene]amino]propanamide |
| SMILES | CCN/C(=N\CCC(=O)NCc1ccccc1)NC(C)CCCN(CC)CC |
| InChI | InChI=1S/C22H39N5O/c1-5-23-22(26-19(4)12-11-17-27(6-2)7-3)24-16-15-21(28)25-18-20-13-9-8-10-14-20/h8-10,13-14,19H,5-7,11-12,15-18H2,1-4H3,(H,25,28)(H2,23,24,26) |
| InChIKey | MYASRPYXJODGBY-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.59 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|