C18H41N5O2S — CID 111759731
1-[5-(diethylamino)pentan-2-yl]-2-[2-(diethylsulfamoyl)ethyl]-3-ethylguanidine (PubChem CID 111759731) has the molecular formula C18H41N5O2S and a molecular weight of 391.63 g/mol. Its IUPAC name is 1-[5-(diethylamino)pentan-2-yl]-2-[2-(diethylsulfamoyl)ethyl]-3-ethylguanidine.
| Compound Name | 1-[5-(diethylamino)pentan-2-yl]-2-[2-(diethylsulfamoyl)ethyl]-3-ethylguanidine |
|---|---|
| PubChem CID | 111759731 |
| Molecular Formula | C18H41N5O2S |
| Molecular Weight | 391.63 g/mol |
| Exact Mass | 391.30 |
| IUPAC Name | 1-[5-(diethylamino)pentan-2-yl]-2-[2-(diethylsulfamoyl)ethyl]-3-ethylguanidine |
| SMILES | CCN/C(=N\CCS(=O)(=O)N(CC)CC)NC(C)CCCN(CC)CC |
| InChI | InChI=1S/C18H41N5O2S/c1-7-19-18(20-14-16-26(24,25)23(10-4)11-5)21-17(6)13-12-15-22(8-2)9-3/h17H,7-16H2,1-6H3,(H2,19,20,21) |
| InChIKey | AERRWZANXVIJQC-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 77.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.63 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|