C21H38IN5O2 — CID 110998526
N-[2-[[[5-(diethylamino)pentan-2-ylamino]-(ethylamino)methylidene]amino]ethyl]-4-hydroxybenzamide;hydroiodide (PubChem CID 110998526) has the molecular formula C21H38IN5O2 and a molecular weight of 519.47 g/mol. Its IUPAC name is N-[2-[[[5-(diethylamino)pentan-2-ylamino]-(ethylamino)methylidene]amino]ethyl]-4-hydroxybenzamide;hydroiodide.
| Compound Name | N-[2-[[[5-(diethylamino)pentan-2-ylamino]-(ethylamino)methylidene]amino]ethyl]-4-hydroxybenzamide;hydroiodide |
|---|---|
| PubChem CID | 110998526 |
| Molecular Formula | C21H38IN5O2 |
| Molecular Weight | 519.47 g/mol |
| Exact Mass | 519.21 |
| IUPAC Name | N-[2-[[[5-(diethylamino)pentan-2-ylamino]-(ethylamino)methylidene]amino]ethyl]-4-hydroxybenzamide;hydroiodide |
| SMILES | CCN/C(=N\CCNC(=O)c1ccc(O)cc1)NC(C)CCCN(CC)CC.I |
| InChI | InChI=1S/C21H37N5O2.HI/c1-5-22-21(25-17(4)9-8-16-26(6-2)7-3)24-15-14-23-20(28)18-10-12-19(27)13-11-18;/h10-13,17,27H,5-9,14-16H2,1-4H3,(H,23,28)(H2,22,24,25);1H |
| InChIKey | BKGNGMGMIPYUQH-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 88.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.47 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|