C21H26F3IN4O2 — CID 111324079
N-[2-[[ethylamino-[1-[3-(trifluoromethyl)phenyl]ethylamino]methylidene]amino]ethyl]-4-hydroxybenzamide;hydroiodide (PubChem CID 111324079) has the molecular formula C21H26F3IN4O2 and a molecular weight of 550.36 g/mol. Its IUPAC name is N-[2-[[ethylamino-[1-[3-(trifluoromethyl)phenyl]ethylamino]methylidene]amino]ethyl]-4-hydroxybenzamide;hydroiodide.
| Compound Name | N-[2-[[ethylamino-[1-[3-(trifluoromethyl)phenyl]ethylamino]methylidene]amino]ethyl]-4-hydroxybenzamide;hydroiodide |
|---|---|
| PubChem CID | 111324079 |
| Molecular Formula | C21H26F3IN4O2 |
| Molecular Weight | 550.36 g/mol |
| Exact Mass | 550.11 |
| IUPAC Name | N-[2-[[ethylamino-[1-[3-(trifluoromethyl)phenyl]ethylamino]methylidene]amino]ethyl]-4-hydroxybenzamide;hydroiodide |
| SMILES | CCN/C(=N\CCNC(=O)c1ccc(O)cc1)NC(C)c1cccc(C(F)(F)F)c1.I |
| InChI | InChI=1S/C21H25F3N4O2.HI/c1-3-25-20(27-12-11-26-19(30)15-7-9-18(29)10-8-15)28-14(2)16-5-4-6-17(13-16)21(22,23)24;/h4-10,13-14,29H,3,11-12H2,1-2H3,(H,26,30)(H2,25,27,28);1H |
| InChIKey | OXQUARPFEKAHQM-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 85.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.36 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|