C20H26F3IN4 — CID 109402462
1-ethyl-2-[2-(3-methyl-4-pyridinyl)ethyl]-3-[1-[3-(trifluoromethyl)phenyl]ethyl]guanidine;hydroiodide (PubChem CID 109402462) has the molecular formula C20H26F3IN4 and a molecular weight of 506.35 g/mol. Its IUPAC name is 1-ethyl-2-[2-(3-methyl-4-pyridinyl)ethyl]-3-[1-[3-(trifluoromethyl)phenyl]ethyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[2-(3-methyl-4-pyridinyl)ethyl]-3-[1-[3-(trifluoromethyl)phenyl]ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 109402462 |
| Molecular Formula | C20H26F3IN4 |
| Molecular Weight | 506.35 g/mol |
| Exact Mass | 506.12 |
| IUPAC Name | 1-ethyl-2-[2-(3-methyl-4-pyridinyl)ethyl]-3-[1-[3-(trifluoromethyl)phenyl]ethyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCc1ccncc1C)NC(C)c1cccc(C(F)(F)F)c1.I |
| InChI | InChI=1S/C20H25F3N4.HI/c1-4-25-19(26-11-9-16-8-10-24-13-14(16)2)27-15(3)17-6-5-7-18(12-17)20(21,22)23;/h5-8,10,12-13,15H,4,9,11H2,1-3H3,(H2,25,26,27);1H |
| InChIKey | MCSNIMOCKSVYDH-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 49.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.35 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|