C22H28N6 — CID 109407453
1-ethyl-2-[2-(3-methyl-4-pyridinyl)ethyl]-3-[1-(3-pyrazol-1-ylphenyl)ethyl]guanidine (PubChem CID 109407453) has the molecular formula C22H28N6 and a molecular weight of 376.51 g/mol. Its IUPAC name is 1-ethyl-2-[2-(3-methyl-4-pyridinyl)ethyl]-3-[1-(3-pyrazol-1-ylphenyl)ethyl]guanidine.
| Compound Name | 1-ethyl-2-[2-(3-methyl-4-pyridinyl)ethyl]-3-[1-(3-pyrazol-1-ylphenyl)ethyl]guanidine |
|---|---|
| PubChem CID | 109407453 |
| Molecular Formula | C22H28N6 |
| Molecular Weight | 376.51 g/mol |
| Exact Mass | 376.24 |
| IUPAC Name | 1-ethyl-2-[2-(3-methyl-4-pyridinyl)ethyl]-3-[1-(3-pyrazol-1-ylphenyl)ethyl]guanidine |
| SMILES | CCN/C(=N\CCc1ccncc1C)NC(C)c1cccc(-n2cccn2)c1 |
| InChI | InChI=1S/C22H28N6/c1-4-24-22(25-13-10-19-9-12-23-16-17(19)2)27-18(3)20-7-5-8-21(15-20)28-14-6-11-26-28/h5-9,11-12,14-16,18H,4,10,13H2,1-3H3,(H2,24,25,27) |
| InChIKey | FYCLFFXPOMNHLJ-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 67.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.51 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|