C17H21N7O — CID 75512876
2-methyl-1-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]-3-[1-(3-pyrazol-1-ylphenyl)ethyl]guanidine (PubChem CID 75512876) has the molecular formula C17H21N7O and a molecular weight of 339.40 g/mol. Its IUPAC name is 2-methyl-1-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]-3-[1-(3-pyrazol-1-ylphenyl)ethyl]guanidine.
| Compound Name | 2-methyl-1-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]-3-[1-(3-pyrazol-1-ylphenyl)ethyl]guanidine |
|---|---|
| PubChem CID | 75512876 |
| Molecular Formula | C17H21N7O |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.18 |
| IUPAC Name | 2-methyl-1-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]-3-[1-(3-pyrazol-1-ylphenyl)ethyl]guanidine |
| SMILES | C/N=C(\NCc1noc(C)n1)NC(C)c1cccc(-n2cccn2)c1 |
| InChI | InChI=1S/C17H21N7O/c1-12(14-6-4-7-15(10-14)24-9-5-8-20-24)21-17(18-3)19-11-16-22-13(2)25-23-16/h4-10,12H,11H2,1-3H3,(H2,18,19,21) |
| InChIKey | CGPOAGIOMNPTOU-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 93.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|