C15H23FN4O — CID 111043668
N-[2-[[amino-(tert-butylamino)methylidene]amino]ethyl]-3-fluoro-4-methylbenzamide (PubChem CID 111043668) has the molecular formula C15H23FN4O and a molecular weight of 294.37 g/mol. Its IUPAC name is N-[2-[[amino-(tert-butylamino)methylidene]amino]ethyl]-3-fluoro-4-methylbenzamide.
| Compound Name | N-[2-[[amino-(tert-butylamino)methylidene]amino]ethyl]-3-fluoro-4-methylbenzamide |
|---|---|
| PubChem CID | 111043668 |
| Molecular Formula | C15H23FN4O |
| Molecular Weight | 294.37 g/mol |
| Exact Mass | 294.19 |
| IUPAC Name | N-[2-[[amino-(tert-butylamino)methylidene]amino]ethyl]-3-fluoro-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)NCC/N=C(\N)NC(C)(C)C)cc1F |
| InChI | InChI=1S/C15H23FN4O/c1-10-5-6-11(9-12(10)16)13(21)18-7-8-19-14(17)20-15(2,3)4/h5-6,9H,7-8H2,1-4H3,(H,18,21)(H3,17,19,20) |
| InChIKey | SKPPSNYREBHZRI-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 79.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.37 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|