C19H28FN5O2 — CID 111927802
N-[2-[[N'-[2-(cyclopropanecarbonylamino)ethyl]-N-ethylcarbamimidoyl]amino]ethyl]-3-fluoro-4-methylbenzamide (PubChem CID 111927802) has the molecular formula C19H28FN5O2 and a molecular weight of 377.46 g/mol. Its IUPAC name is N-[2-[[N'-[2-(cyclopropanecarbonylamino)ethyl]-N-ethylcarbamimidoyl]amino]ethyl]-3-fluoro-4-methylbenzamide.
| Compound Name | N-[2-[[N'-[2-(cyclopropanecarbonylamino)ethyl]-N-ethylcarbamimidoyl]amino]ethyl]-3-fluoro-4-methylbenzamide |
|---|---|
| PubChem CID | 111927802 |
| Molecular Formula | C19H28FN5O2 |
| Molecular Weight | 377.46 g/mol |
| Exact Mass | 377.22 |
| IUPAC Name | N-[2-[[N'-[2-(cyclopropanecarbonylamino)ethyl]-N-ethylcarbamimidoyl]amino]ethyl]-3-fluoro-4-methylbenzamide |
| SMILES | CCN/C(=N\CCNC(=O)C1CC1)NCCNC(=O)c1ccc(C)c(F)c1 |
| InChI | InChI=1S/C19H28FN5O2/c1-3-21-19(24-10-8-22-17(26)14-6-7-14)25-11-9-23-18(27)15-5-4-13(2)16(20)12-15/h4-5,12,14H,3,6-11H2,1-2H3,(H,22,26)(H,23,27)(H2,21,24,25) |
| InChIKey | AAUOKQFMINZUDI-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 94.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.46 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|