C16H21FN4O — CID 136921877
N-[2-[[ethylamino-(prop-2-ynylamino)methylidene]amino]ethyl]-3-fluoro-4-methylbenzamide (PubChem CID 136921877) has the molecular formula C16H21FN4O and a molecular weight of 304.37 g/mol. Its IUPAC name is N-[2-[[ethylamino-(prop-2-ynylamino)methylidene]amino]ethyl]-3-fluoro-4-methylbenzamide.
| Compound Name | N-[2-[[ethylamino-(prop-2-ynylamino)methylidene]amino]ethyl]-3-fluoro-4-methylbenzamide |
|---|---|
| PubChem CID | 136921877 |
| Molecular Formula | C16H21FN4O |
| Molecular Weight | 304.37 g/mol |
| Exact Mass | 304.17 |
| IUPAC Name | N-[2-[[ethylamino-(prop-2-ynylamino)methylidene]amino]ethyl]-3-fluoro-4-methylbenzamide |
| SMILES | C#CCN/C(=N/CCNC(=O)c1ccc(C)c(F)c1)NCC |
| InChI | InChI=1S/C16H21FN4O/c1-4-8-20-16(18-5-2)21-10-9-19-15(22)13-7-6-12(3)14(17)11-13/h1,6-7,11H,5,8-10H2,2-3H3,(H,19,22)(H2,18,20,21) |
| InChIKey | KOFKDYWQGLPVTK-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.37 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|