C20H30FN5O3 — CID 111162624
ethyl 4-[N-ethyl-N'-[2-[(3-fluoro-4-methylbenzoyl)amino]ethyl]carbamimidoyl]piperazine-1-carboxylate (PubChem CID 111162624) has the molecular formula C20H30FN5O3 and a molecular weight of 407.49 g/mol. Its IUPAC name is ethyl 4-[N-ethyl-N'-[2-[(3-fluoro-4-methylbenzoyl)amino]ethyl]carbamimidoyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[N-ethyl-N'-[2-[(3-fluoro-4-methylbenzoyl)amino]ethyl]carbamimidoyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 111162624 |
| Molecular Formula | C20H30FN5O3 |
| Molecular Weight | 407.49 g/mol |
| Exact Mass | 407.23 |
| IUPAC Name | ethyl 4-[N-ethyl-N'-[2-[(3-fluoro-4-methylbenzoyl)amino]ethyl]carbamimidoyl]piperazine-1-carboxylate |
| SMILES | CCN/C(=N\CCNC(=O)c1ccc(C)c(F)c1)N1CCN(C(=O)OCC)CC1 |
| InChI | InChI=1S/C20H30FN5O3/c1-4-22-19(25-10-12-26(13-11-25)20(28)29-5-2)24-9-8-23-18(27)16-7-6-15(3)17(21)14-16/h6-7,14H,4-5,8-13H2,1-3H3,(H,22,24)(H,23,27) |
| InChIKey | SQLDXHRUCMTWDK-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 86.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.49 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|